| Compound ID | 2540 |
| Compound Structure |  |
| Plant Source | Salvia multicaulis Vahl Common Name: |
| Source Family | Lamiaceae |
| Origin | Turkey |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 12 - Demethylmultiorthoquinone |
| PubChem ID | 467785 |
| Ethnomedicinal Information | Used in traditional medicine and have been associated with antibacterial, antituberculous and antiphlogistic activities |
| PubMed ID [Source Literature] | 9428161 |
| Extract Preparation | The powdered roots of S. multicaulis (940 g) were extracted with acetone in a Soxhlet apparatus. The extract was evaporated in vacuo to give 23 g of a residue. The residue was fractionated by column chromatography on a silica gel column, eluted with petroleum ether, followed by a gradient of EtOAc up to 100% and then with EtOH. After TLC analysis, the combined fractions were purified by vacuum-liquid chromatography (VLC), eluting with petroleum ether and ethyl acetate |
| Chemical Classification [Active Compound] | Aromatic, Phenanthrene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 294.126 |
| Molecular Formula | C19H18O3
|
| SMILES | O=C1c2c3c(c(c(c(O)c3)C)C)ccc2C=C(C(C)C)C1=O |
| XLogP | 4.117 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Ulubelen A, Topcu G, Johansson CB.Norditerpenoids and diterpenoids from Salvia multicaulis with antituberculous activity.J Nat Prod. 1997 Dec;60(12):1275-80
|
| Curator | |
