| Compound ID | 3644 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Arnidiol |
| PubChem ID | 470259 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1[C@@]2([C@H]([C@@H]3[C@]([C@]4(C([C@@]5([C@@H](CC4)C([C@@H](O)CC5)(C)C)C)CC3)C)(C1)C)[C@@H](C(=C)CC2)C)C |
| XLogP | 9.289 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
