| Compound ID | 2510 |
| Compound Structure |  |
| Plant Source | Rudbeckia submentosa Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Root, leaf, stem, flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Oxoalloalatolactone |
| PubChem ID | 474519 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Ketone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3
|
| SMILES | O1[C@@H]2C[C@@]3(C(=C(C(=O)CC3)C)C[C@@H]2C(=C)C1=O)C |
| XLogP | 0.918 |
| PSA | 43.370 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
|
| Curator | |
