| Compound ID | 2621 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Entabietic acid |
| PubChem ID | 479912 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.250 |
| Molecular Formula | C20H32
|
| SMILES | [C@@]12([C@@H](C(CCC1)(C)C)CC=C1[C@H]2CCC(=C1)C(C)C)C |
| XLogP | 8.607 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 3981 |
| Compound Structure | |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Entabietic acid |
| PubChem ID | 479912 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 272.250 |
| Molecular Formula | C20H32
|
| SMILES | [C@@]12([C@@H](C(CCC1)(C)C)CC=C1[C@H]2CCC(=C1)C(C)C)C |
| XLogP | 8.607 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
