| Compound ID | 1962 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 14.4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Juniperexcelsic acid |
| PubChem ID | 490535 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acetyl, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 362.246 |
| Molecular Formula | C22H34O4 |
| SMILES | O(C1[C@](C2[C@@](C(C(CC2)C)CCC(=C)C=C)(CC1)C)(C)C(=O)O)C(=O)C |
| XLogP | 6.661 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
