| Compound ID | 3400 |
| Compound Structure |  |
| Plant Source | Melia volkensii Gurke Common Name: |
| Source Family | Meliaceae |
| Origin | Voi, Kenya |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Kulonate |
| PubChem ID | 490539 |
| Ethnomedicinal Information | Used in folk medicine to alleviate pain - tea prepared from bark |
| PubMed ID [Source Literature] | 10217705 |
| Extract Preparation | Crushed seeds (1 kg) were allowed to stand in 2 l of MeOH for 1 week |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Ester, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 526.366 |
| Molecular Formula | C33H50O5
|
| SMILES | O1[C@@H]2[C@H]([C@]3([C@](C2)(C2=CC[C@@H]4[C@@](C2CC3)(CCC(=O)C4(C)C)C)C)C)[C@@H]([C@H]1O)[C@@H](CCC=C(C)C)C(=O)OC |
| XLogP | 6.712 |
| PSA | 72.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fischer NH.Antimycobacterial triterpenes from Melia volkensii.J Nat Prod. 1999 Apr;62(4):546-8
|
| Curator | Vikramjitmandal |
