| Compound ID | 3682 |
| Compound Structure |  |
| Plant Source | Evodia rutaecarpa (Juss.) Benth. Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Unripe Fruit |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (16 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - Methyl - 4 - Methylidene - 2 - [(6E, 9E) - Pentadeca - 6, 9 - Dien - 1 - Yl] - 1, 4 - Dihydroquinoline |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16051468 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Quinolone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 365.272 |
| Molecular Formula | C25H35NO |
| SMILES | CCCCC/C=C/C/C=C/CCCCCc1cc(=O)c2c(cccc2)n1C |
| XLogP | 8.963 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Adams M, Wube AA, Bucar F, Bauer R, Kunert O, Haslinger E.Quinolone alkaloids from Evodia rutaecarpa: a potent new group of antimycobacterial compounds.Int J Antimicrob Agents. 2005 Sep;26(3):262-4
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3687 |
| Compound Structure | |
| Plant Source | Evodia rutaecarpa (Juss.) Benth. Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Unripe Fruit |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 19429) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - Methyl - 4 - Methylidene - 2 - [(6E, 9E) - Pentadeca - 6, 9 - Dien - 1 - Yl] - 1, 4 - Dihydroquinoline |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16051468 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Quinolone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 365.272 |
| Molecular Formula | C25H35NO |
| SMILES | CCCCC/C=C/C/C=C/CCCCCc1cc(=O)c2c(cccc2)n1C |
| XLogP | 8.963 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Adams M, Wube AA, Bucar F, Bauer R, Kunert O, Haslinger E.Quinolone alkaloids from Evodia rutaecarpa: a potent new group of antimycobacterial compounds.Int J Antimicrob Agents. 2005 Sep;26(3):262-4
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3692 |
| Compound Structure | |
| Plant Source | Evodia rutaecarpa (Juss.) Benth. Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Unripe Fruit |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium phlei (ATCC 19249) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - Methyl - 4 - Methylidene - 2 - [(6E, 9E) - Pentadeca - 6, 9 - Dien - 1 - Yl] - 1, 4 - Dihydroquinoline |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16051468 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Quinolone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 365.272 |
| Molecular Formula | C25H35NO |
| SMILES | CCCCC/C=C/C/C=C/CCCCCc1cc(=O)c2c(cccc2)n1C |
| XLogP | 8.963 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Adams M, Wube AA, Bucar F, Bauer R, Kunert O, Haslinger E.Quinolone alkaloids from Evodia rutaecarpa: a potent new group of antimycobacterial compounds.Int J Antimicrob Agents. 2005 Sep;26(3):262-4
|
| Curator | Vsheeba, vikramjitmandal |
