| Compound ID | 2551 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (1.14 ± 0.02 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 9.61 ± 4.52 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sanguinarine |
| PubChem ID | 5154 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.092 |
| Molecular Formula | C20H14NO4
|
| SMILES | O1c2c3c(c4c([n+](c3)C)c3c(cc4)cc4OCOc4c3)ccc2OC1 |
| XLogP | 3.297 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2552 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (0.17 ± 0.04 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 41.18 ± 16.85 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sanguinarine |
| PubChem ID | 5154 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.092 |
| Molecular Formula | C20H14NO4
|
| SMILES | O1c2c3c(c4c([n+](c3)C)c3c(cc4)cc4OCOc4c3)ccc2OC1 |
| XLogP | 3.297 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2553 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 24.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sanguinarine |
| PubChem ID | 5154 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.092 |
| Molecular Formula | C20H14NO4
|
| SMILES | O1c2c3c(c4c([n+](c3)C)c3c(cc4)cc4OCOc4c3)ccc2OC1 |
| XLogP | 3.297 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |