| Compound ID | 1753 |
| Compound Structure |  |
| Plant Source | Ficus nervosa Synonym : Ficus angustifolia Roxb Common Name:Wild Banyan Tree (English) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7 H10 agar method |
| Positive Control Used (conc.) | Ethambutol (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 70 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Apigenin |
| PubChem ID | 5280443 |
| Ethnomedicinal Information | Used in treatment of cough and asthma |
| PubMed ID [Source Literature] | 20658670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 270.053 |
| Molecular Formula | C15H10O5
|
| SMILES | O1c2c(c(=O)cc1c1ccc(O)cc1)c(O)cc(O)c2 |
| XLogP | 1.126 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Chen LW, Cheng MJ, Peng CF, Chen IS. Secondary Metabolites and Antimycobacterial Activities from the Roots of Ficus nervosa, Chemistry & Biodiversity Volume 7, Issue 7, pages 1814–1821, July 2010
|
| Curator | |
