| Compound ID | 2207 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Indo - Pacific region |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude ethanol extract - 89 % and hexane fraction - 95 % |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Stigmasterol |
| PubChem ID | 5280794 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 412.371 |
| Molecular Formula | C29H48O
|
| SMILES | O[C@@H]1CC2=CC[C@H]3[C@H]4[C@@]([C@H](CC4)[C@H](C)/C=C/[C@H](C(C)C)CC)(CC[C@@H]3[C@]2(CC1)C)C |
| XLogP | 11.071 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |
| Compound ID | 2961 |
| Compound Structure | |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Stigmasterol |
| PubChem ID | 5280794 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 412.371 |
| Molecular Formula | C29H48O |
| SMILES | O[C@@H]1CC2=CC[C@H]3[C@H]4[C@@]([C@H](CC4)[C@H](C)/C=C/[C@H](C(C)C)CC)(CC[C@@H]3[C@]2(CC1)C)C |
| XLogP | 11.071 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
