| Compound ID | 1657 |
| Compound Structure |  |
| Plant Source | Erythrina indica Common Name: |
| Source Family | Leguminosae |
| Origin | Ibadan, Nigeria |
| Plant Part Used | Root bark |
| Extract | Phenol |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | Streptomycin (1.7 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 400 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cajanin |
| PubChem ID | 5281706 |
| Ethnomedicinal Information | Trachoma, Elephantiasis, Microbial infections |
| PubMed ID [Source Literature] | 10820816 |
| Extract Preparation | Dried and ground root bark of Erythrina indica was successively extracted with a mixture of dichloro-methane-MeOH (1:1) and methanol. The dichloro-methane-MeOH (1:1) extract was concentrated to dryness |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 300.063 |
| Molecular Formula | C16H12O6
|
| SMILES | O1c2c(c(=O)c(c3c(O)cc(O)cc3)c1)c(O)cc(OC)c2 |
| XLogP | 0.781 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Waffo AK, Azebaze GA, Nkengfack AE, Fomum ZT, Meyer M, Bodo B, van Heerden FR.Indicanines B and C, two isoflavonoid derivatives from the root bark of Erythrina indica.Phytochemistry. 2000 Apr;53(8):981-5
|
| Curator | |
| Compound ID | 1749 |
| Compound Structure | |
| Plant Source | Ficus nervosa Common Name:Wild Banyan Tree (English) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7 H10 agar method |
| Positive Control Used (conc.) | Ethambutol (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 110 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cajanin |
| PubChem ID | 5281706 |
| Ethnomedicinal Information | Used in treatment of cough and asthma |
| PubMed ID [Source Literature] | 20658670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 300.063 |
| Molecular Formula | C16H12O6
|
| SMILES | O1c2c(c(=O)c(c3c(O)cc(O)cc3)c1)c(O)cc(OC)c2 |
| XLogP | 0.781 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Chen LW, Cheng MJ, Peng CF, Chen IS. Secondary Metabolites and Antimycobacterial Activities from the Roots of Ficus nervosa, Chemistry & Biodiversity Volume 7, Issue 7, pages 1814–1821, July 2010
|
| Curator | |
