| Compound ID | 1840 |
| Compound Structure |  |
| Plant Source | Haplopappus sonoriensis Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 48 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Kumatakenin |
| PubChem ID | 5318869 |
| Ethnomedicinal Information | Antiulcer, antiviral |
| PubMed ID [Source Literature] | 12727485 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against human colorectal cancer cells, HCT-116 (ATCC CCL-247) |
| Molecular Weight | 314.079 |
| Molecular Formula | C17H14O6
|
| SMILES | O1c2c(c(=O)c(OC)c1c1ccc(O)cc1)c(O)cc(OC)c2 |
| XLogP | 2.021 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Murillo JI, Encarnación-Dimayuga R, Malmstrĝm J, Christophersen C, Franzblau SG. Antimycobacterial flavones from Haplopappus sonorensis.Fitoterapia Volume 74, Issue 3, April 2003, Pages 226-230
|
| Curator | |
| Compound ID | 3046 |
| Compound Structure | |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Kumatakenin |
| PubChem ID | 5318869 |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n-butanol |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 314.079 |
| Molecular Formula | C17H14O6 |
| SMILES | O1c2c(c(=O)c(OC)c1c1ccc(O)cc1)c(O)cc(OC)c2 |
| XLogP | 2.021 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal, farzana-shamsudeen-shamsudeen |
