| Compound ID | 1783 |
| Compound Structure |  |
| Plant Source | Galenia africana L. Common Name:Yellow Bush |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Hexane:Ethyl acetate |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Rapid Radiometric Method using BACTEC - 460 System |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 31.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 2` - Trihydroxyflavone |
| PubChem ID | 5322064 |
| Ethnomedicinal Information | Chest pains, tuberculosis, asthma |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 270.053 |
| Molecular Formula | C15H10O5
|
| SMILES | O1c2c(c(=O)cc1c1c(O)cccc1)c(O)cc(O)c2 |
| XLogP | 1.337 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1784 |
| Compound Structure | |
| Plant Source | Galenia africana L. Common Name:Yellow Bush |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Hexane:Ethyl acetate |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Rapid Radiometric Method using BACTEC - 460 System |
| Positive Control Used (conc.) | Isoniazid (0.2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 2` - Trihydroxyflavone |
| PubChem ID | 5322064 |
| Ethnomedicinal Information | Chest pains, tuberculosis, asthma |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 270.053 |
| Molecular Formula | C15H10O5
|
| SMILES | O1c2c(c(=O)cc1c1c(O)cccc1)c(O)cc(O)c2 |
| XLogP | 1.337 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
