| Compound ID | 3661 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (24S) - Cycloartane - 3β, 24, 25 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 460.392 |
| Molecular Formula | C30H52O3 |
| SMILES | C1C[C@@H](C([C@H]2C31C1([C@@H](CC2)[C@]2([C@](CC1)([C@H](CC2)[C@H](C)CCC(C(C)(C)O)O)C)C)C3)(C)C)O |
| XLogP | 9.572 |
| PSA | 60.690 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
