| Compound ID | 2457 |
| Compound Structure |  |
| Plant Source | Psoralea corylifoila L. Common Name:Babchi, Purple Fleabane (English), Somaraaji, Somavalli, Somavallik (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (1.14 ± 0.02 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15.79 ± 10.66 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bakuchiol |
| PubChem ID | 5468522 |
| Ethnomedicinal Information | Leprosy, asthma, bronchitis, respiratory diseases, various fevers, pulmonary disorders |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 256.183 |
| Molecular Formula | C18H24O |
| SMILES | Oc1ccc(/C=C/[C@](CCC=C(C)C)(C)C=C)cc1 |
| XLogP | 7.589 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2458 |
| Compound Structure | |
| Plant Source | Psoralea corylifoila L. Common Name:Babchi, Purple Fleabane (English), Somaraaji, Somavalli, Somavallik (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (0.17 ± 0.04 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bakuchiol |
| PubChem ID | 5468522 |
| Ethnomedicinal Information | Leprosy, asthma, bronchitis, respiratory diseases, various fevers, pulmonary disorders |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 256.183 |
| Molecular Formula | C18H24O |
| SMILES | Oc1ccc(/C=C/[C@](CCC=C(C)C)(C)C=C)cc1 |
| XLogP | 7.589 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2459 |
| Compound Structure | |
| Plant Source | Psoralea corylifoila L. Common Name:Babchi, Purple Fleabane (English), Somaraaji, Somavalli, Somavallik (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | |
| Target Bacteria | Mycobacterium bovis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 21.4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bakuchiol |
| PubChem ID | 5468522 |
| Ethnomedicinal Information | Leprosy, asthma, bronchitis, respiratory diseases, various fevers, pulmonary disorders |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 256.183 |
| Molecular Formula | C18H24O |
| SMILES | Oc1ccc(/C=C/[C@](CCC=C(C)C)(C)C=C)cc1 |
| XLogP | 7.589 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
