| Compound ID | 1838 |
| Compound Structure |  |
| Plant Source | Haplopappus sonoriensis Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 33 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5 - Hydroxy - 3, 7, 4` - Trimethoxyflavone |
| PubChem ID | 5468749 |
| Ethnomedicinal Information | To treat coughs |
| PubMed ID [Source Literature] | 12727485 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against human colorectal cancer cells, HCT-116 (ATCC CCL-247) |
| Molecular Weight | 328.095 |
| Molecular Formula | C18H16O6
|
| SMILES | O1c2c(c(=O)c(OC)c1c1ccc(OC)cc1)c(O)cc(OC)c2 |
| XLogP | 2.540 |
| PSA | 64.990 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Murillo JI, Encarnación-Dimayuga R, Malmstrĝm J, Christophersen C, Franzblau SG. Antimycobacterial flavones from Haplopappus sonorensis.Fitoterapia Volume 74, Issue 3, April 2003, Pages 226-230
|
| Curator | |
