| Compound ID | 2275 |
| Compound Structure |  |
| Plant Source | Oplopanax horridus Smith Miq. Common Name:Devil's Club |
| Source Family | Araliaceae |
| Origin | USA |
| Plant Part Used | Inner bark |
| Extract | Methanol, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 20 µg/disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Falcarinol |
| PubChem ID | 5469789 |
| Ethnomedicinal Information | Diabetes, rheumatism, tuberculosis, colds, headaches and lung ailments |
| PubMed ID [Source Literature] | 9392889 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 244.183 |
| Molecular Formula | C17H24O |
| SMILES | O[C@H](C#CC#CC/C=CCCCCCCC)C=C |
| XLogP | 6.197 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Kobaisy M, Abramowski Z, Lermer L, Saxena G, Hancock RE, Towers GH, Doxsee D, Stokes RW.Antimycobacterial polyynes of Devils Club (Oplopanax horridus), a North American native medicinal plant.J Nat Prod. 1997 Nov;60(11):1210-3
2) Turner, N. J., L. C. Thompson, M. T. Thompson and A. Z. York. 1990. Thompson Ethnobotany: Knowledge and Usage of Plants by the Thompson Indians of British Columbia. Victoria, British Columbia, Royal British Columbia Museum
|
| Curator | |
