| Compound ID | 3756 |
| Compound Structure |  |
| Plant Source | Tetradium danielli Benn. Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dimethyl Octadienyloxy Furobenzopyran - 7 - One |
| PubChem ID | 5471349 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16981128 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Furanoid, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4 |
| SMILES | O(c1c2c(occ2)cc2oc(=O)ccc12)C/C=C(/CCC=C(C)C)C |
| XLogP | 5.237 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Adams M, Ettl S, Kunert O, Wube AA, Haslinger E, Bucar F, Bauer R.Antimycobacterial activity of geranylated furocoumarins from Tetradium daniellii.Planta Med. 2006 Oct;72(12):1132-5. Epub 2006 Sep 18
|
| Curator | Rachana, vikramjitmandal |
