| Compound ID | 1363 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 6, 7 - Trihydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479777 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 304.058 |
| Molecular Formula | C15H12O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(O)c2OC |
| XLogP | -0.163 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |