| Compound ID | 1959 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Communic Acid |
| PubChem ID | 637125 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2 |
| SMILES | OC(=O)[C@@]1([C@H]2[C@@]([C@H](C(=C)CC2)C/C=C(C)/C=C)(CCC1)C)C |
| XLogP | 6.407 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
