| Compound ID | 2274 |
| Compound Structure |  |
| Plant Source | Oplopanax horridus Smith Miq. Common Name:Devil's Club |
| Source Family | Araliaceae |
| Origin | USA |
| Plant Part Used | Inner bark |
| Extract | Methanol, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid (100 µg/disk) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 100 µg/disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | Diabetes, rheumatism, tuberculosis, colds, headaches and lung ailments |
| PubMed ID [Source Literature] | 9392889 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Kobaisy M, Abramowski Z, Lermer L, Saxena G, Hancock RE, Towers GH, Doxsee D, Stokes RW.Antimycobacterial polyynes of Devils Club (Oplopanax horridus), a North American native medicinal plant.J Nat Prod. 1997 Nov;60(11):1210-3
2) Turner, N. J., L. C. Thompson, M. T. Thompson and A. Z. York. 1990. Thompson Ethnobotany: Knowledge and usage of plants by the Thompson Indians of British Columbia. Victoria: Royal British Columbia Museum, Memoir No. 3
|
| Curator | |
| Compound ID | 3711 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium abscessus (ATCC 19977) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3712 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3713 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3714 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3805 |
| Compound Structure |  |
| Plant Source | Angelica sinensis Common Name:Dang Gui |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Northwest China |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 26.7 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18567055 |
| Extract Preparation | 8 kg of the pulverized roots of Angelica sinensis Diels were extracted with methanol and the extract sequentially partitioned with petroleum ether, CHCl3, and BuOH |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Deng S, Wang Y, Inui T, Chen SN, Farnsworth NR, Cho S, Franzblau SG, Pauli GF.Anti-TB polyynes from the roots of Angelica sinensis.Phytother Res. 2008 Jul;22(7):878-82
|
| Curator | KeyaMukherjee, reshmi, Farzana Shamsudeen, Vikramjitmandal |
| Compound ID | 3810 |
| Compound Structure |  |
| Plant Source | Angelica sinensis Common Name:Dang Gui |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Northwest China |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis (Erdman) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18567055 |
| Extract Preparation | 8 kg of the pulverized roots of Angelica sinensis Diels were extracted with methanol and the extract sequentially partitioned with petroleum ether, CHCl3, and BuOH |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Deng S, Wang Y, Inui T, Chen SN, Farnsworth NR, Cho S, Franzblau SG, Pauli GF.Anti-TB polyynes from the roots of Angelica sinensis.Phytother Res. 2008 Jul;22(7):878-82
|
| Curator | KeyaMukherjee, reshmi, Farzana Shamsudeen, Vikramjitmandal |