| Compound ID | 2899 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2900 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35822) (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.12 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2901 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35838) (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2902 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35820) (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.12 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2903 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35837) (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2904 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate MMDO) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.12 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2905 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY650) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2906 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY663) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2907 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY675) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2908 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY282) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2909 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate HG8) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.12 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2910 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN3) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2911 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY234) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2912 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY112) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2913 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY559) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2914 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN4) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.12 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4 |
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal, farzana-shamsudeen-shamsudeen |
| Compound ID | 2915 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY172) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin A |
| PubChem ID | 6442393 |
| Ethnomedicinal Information | Cough and snake bites |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4 |
| SMILES | O1[C@H]([C@@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc(OC)c(O)cc1 |
| XLogP | 4.363 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal, farzana-shamsudeen-shamsudeen |