| Compound ID | 2432 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Potamogetonin |
| PubChem ID | 6453492 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Furanoid, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 314.188 |
| Molecular Formula | C20H26O3 |
| SMILES | CC12CCCC3(C1CCC(=C)C3CCC4=COC=C4)C(=O)OC2 |
| XLogP | 4.183 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
