| Compound ID | 2102 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,10-Epoxycostunolide |
| PubChem ID | 6474991 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1C2([C@H]1CC/C(=C/[C@H]1OC(=O)C(=C)[C@@H]1CC2)/C)C |
| XLogP | 2.082 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castaņeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2105 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,10-Epoxycostunolide |
| PubChem ID | 6474991 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1C2([C@H]1CC/C(=C/[C@H]1OC(=O)C(=C)[C@@H]1CC2)/C)C |
| XLogP | 2.082 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castaņeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
