| Compound ID | 1805 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostinone |
| PubChem ID | 6478778 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 380.162 |
| Molecular Formula | C23H24O5
|
| SMILES | O1c2c(c(O)c(C/C=C(/CCC=C(C)C)C)c(O)c2)c(=O)c2c1c(O)ccc2 |
| XLogP | 3.588 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
