| Compound ID | 3746 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Betulinic acid |
| PubChem ID | 64971 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4([C@@H]([C@@H]5[C@@](CC4)(CC[C@H]5C(=C)C)C(=O)O)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.407 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
