| Compound ID | 3108 |
| Compound Structure |  |
| Plant Source | Calophyllum lanigerum var. austrocoriaceum Common Name:NR |
| Source Family | Clusiaceae |
| Origin | Malaysian rain forest |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 - 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (+)- Calanolide A |
| PubChem ID | 64972 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16138106 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Coumarin, Benzopyran, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 370.178 |
| Molecular Formula | C22H26O5 |
| SMILES | O1[C@@H]([C@H]([C@H](O)c2c1c1c(OC(C=C1)(C)C)c1c2oc(=O)cc1CCC)C)C |
| XLogP | 4.029 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Pink R, Hudson A, Mouriès MA, Bendig M.Opportunities and challenges in antiparasitic drug discovery.Nat Rev Drug Discov. 2005 Sep;4(9):727-40
|
| Curator | Reshmi, gppreetha |
