| Compound ID | 2531 |
| Compound Structure |  |
| Plant Source | Salvia Africana-lutea Common Name:Beach Salvia, Dune Salvia |
| Source Family | Lamiaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Carnosic acid |
| PubChem ID | 65126 |
| Ethnomedicinal Information | Infections, tuberculosis, fever |
| PubMed ID [Source Literature] | 17256988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy, Acid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.199 |
| Molecular Formula | C20H28O4
|
| SMILES | OC(=O)[C@@]12[C@H](C(CCC1)(C)C)CCc1c2c(O)c(O)c(c1)C(C)C |
| XLogP | 5.183 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Hussein AA, Meyer JJ, Jimeno ML, Reodríguez B.Bioactive diterpenes from Orthosiphon labiatus and Salvia africana-luta.J Nat Prod. 2007 Feb;70(2):293-5
2) Seaman, T., 2005. The antimicrobial and antimycobacterial activity of plants used for the treatment of respiratory ailments in Southern Africa and the isolation of anacardic acid from Ozoroa paniculosa. M.Sc. Dissertation. University of the Witwatersrand, South Africa
|
| Curator | |
| Compound ID | 2532 |
| Compound Structure |  |
| Plant Source | Salvia Africana-lutea Common Name:Beach Salvia, Dune Salvia |
| Source Family | Lamiaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 9 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Carnosic acid |
| PubChem ID | 65126 |
| Ethnomedicinal Information | Infections, tuberculosis, fever |
| PubMed ID [Source Literature] | 17256988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy, Acid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.199 |
| Molecular Formula | C20H28O4
|
| SMILES | OC(=O)[C@@]12[C@H](C(CCC1)(C)C)CCc1c2c(O)c(O)c(c1)C(C)C |
| XLogP | 5.183 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Hussein AA, Meyer JJ, Jimeno ML, Rodríguez B.Bioactive diterpenes from Orthosiphon labiatus and Salvia africana-lutea.J Nat Prod. 2007 Feb;70(2):293-5
|
| Curator | |
| Compound ID | 2533 |
| Compound Structure |  |
| Plant Source | Salvia Africana-lutea Common Name:Beach Salvia, Dune Salvia |
| Source Family | Lamiaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Carnosic acid |
| PubChem ID | 65126 |
| Ethnomedicinal Information | Infections, tuberculosis, fever |
| PubMed ID [Source Literature] | 17256988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy, Acid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.199 |
| Molecular Formula | C20H28O4
|
| SMILES | OC(=O)[C@@]12[C@H](C(CCC1)(C)C)CCc1c2c(O)c(O)c(c1)C(C)C |
| XLogP | 5.183 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Hussein AA, Meyer JJ, Jimeno ML, Rodríguez B.Bioactive diterpenes from Orthosiphon labiatus and Salvia africana-lutea.J Nat Prod. 2007 Feb;70(2):293-5
2) Seaman, T., 2005. The antimicrobial and antimycobacterial activity of plants used for the treatment of respiratory ailments in Southern Africa and the isolation of anacardic acid from Ozoroa paniculosa. M.Sc. Dissertation. University of the Witwatersrand, South Africa
|
| Curator | |