| Compound ID | 2589 |
| Compound Structure |  |
| Plant Source | Senna obliqua (G.Don) I. & B. Common Name: |
| Source Family | Fabaceae |
| Origin | Peru |
| Plant Part Used | Fruit, stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) radiometric assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 12 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Rubrofusarin |
| PubChem ID | 72537 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14987063 |
| Extract Preparation | The air-dried stem and fruits of S. obliqua (1.6 kg) were combined, milled, and extracted with MeOH (3 × 6.5 L). The successive extracts were concentrated in vacuo to give a residue (430 g), which was submitted to solvent partitioning between CHCl3 and H2O to afford a CHCl3-soluble (33.3 g) and a H2O-soluble fraction (397.5 g) |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Napthopyrone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.068 |
| Molecular Formula | C15H12O5 |
| SMILES | O1c2c(c(O)c3c(c2)cc(OC)cc3O)c(=O)cc1C |
| XLogP | 0.564 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Graham JG, Zhang H, Pendland SL, Santarsiero BD, Mesecar AD, Cabieses F, Farnsworth NR.Antimycobacterial Naphthopyrones from Senna obliqua.J Nat Prod. 2004 Feb;67(2):225-7
|
| Curator | |
