| Compound ID | 3061 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostus lactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3062 |
| Compound Structure | |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostus lactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3770 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (pan-susceptible) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3771 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Isoniazid resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3772 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3773 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Streptomycin resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3774 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Ethambutol resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3775 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate MMDO, isoniazid and ethambutol resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3776 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN4), (Isoniazid, rifampicin, streptomycin and ethambutol resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
| Compound ID | 3777 |
| Compound Structure | |
| Plant Source | Laurus novocanariensis Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | Ripe fruit |
| Extract | Laurel oil |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate MTY 147), (Isoniazid and rifampicin resistant) |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostuslactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17218447 |
| Extract Preparation | Volatile components were removed by hydrodistillation of the oil in a Clevenger - type apparatus to yield the essential oil and an odourless residue containing the lipids and other non - volatile compounds. The residue was partitioned between n - hexane and methanol to separate the lipid fraction from the more polar compounds, including the lactones. The methanolic fraction containing mainly the lactones costunolide (1) and dehydrocostuslactone (2) was further fractioned by column chromatography. 1 and 2 were identified by their mass spectra, and proton and carbon NMR spectra and their purity established as > 95 % by gas chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Luna-Herrera J, Costa MC, González HG, Rodrigues AI, Castilho PC.Synergistic antimycobacterial activities of sesquiterpene lactones from Laurus spp.J Antimicrob Chemother. 2007 Mar;59(3):548-52
|
| Curator | Vikramjitmandal |
