| Compound ID | 1972 |
| Compound Structure |  |
| Plant Source | Kaempferia parviflora Common Name:Krachai Dhum |
| Source Family | Zingiberaceae |
| Origin | Asia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulfate (2.0 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 4` - Trimethoxyflavone |
| PubChem ID | 79730 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | 14693228 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB (oral human epidermoid carcinoma), BC (breast cancer), and NCI-H187 (human, small cell lung cancer) cell lines |
| Molecular Weight | 312.100 |
| Molecular Formula | C18H16O5 |
| SMILES | O1c2c(c(OC)cc(OC)c2)c(=O)cc1c1ccc(OC)cc1 |
| XLogP | 2.683 |
| PSA | 44.760 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Yenjai C, Prasanphen K, Daodee S, Wongpanich V, Kittakoop P.Bioactive flavonoids from Kaempferia parviflora.Fitoterapia. 2004 Jan;75(1):89-92
|
| Curator | |
