| Compound ID | 3002 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M3 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3003 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M4 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3004 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M5 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3005 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M6 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3006 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M8 (Isoniazid, Rifampin, Ethambutol, Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3007 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M11 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3008 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M16 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3009 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M21 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3010 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M22 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3011 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M27 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3012 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M46 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol, Streptomycin, Ofloxacin and Ciprofloxacin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3013 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M48 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol, Streptomycin, Ofloxacin and Ciprofloxacin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3014 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M53 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol, Streptomycin, Ofloxacin and Ciprofloxacin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole (Pentylation on the other ring) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)OCCCCC)OC)on1)O)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | KeyaMukherjee, vsheeba |