| Compound ID | 3044 |
| Compound Structure |  |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sitosteryl - 3 - O - 6 - Palmitoyl - β - D - glucoside |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n - butanol |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Triterpene, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 646.481 |
| Molecular Formula | C39H66O7
|
| SMILES | C1C[C@@H](CC2=CCC3C([C@@]12C)CC[C@@]1([C@H](CCC31)[C@H](C)CC[C@@H](CC)C(C)C)C)OC1OC(C(C(C1O)O)O)COC(=O)CCC |
| XLogP | 11.620 |
| PSA | 105.450 |
| H-bond Donor | 3 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal |
