| Compound ID | 1036 |
| Compound Structure | |
| Plant Source | Achyranthus aspera Linn. Common Name:Prickly Chaff Flower (English), Apaamaarga (Sanskrit) |
| Source Family | Amaranthaceae |
| Origin | India |
| Plant Part Used | Fruit, whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, bronchitis, expectorant, asthma, cough, pulmonary infections, skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1103 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3130 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1119 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1145 |
| Compound Structure | |
| Plant Source | Alnus rubra Bong Common Name:Red Alder |
| Source Family | Betulaceae |
| Origin | British Columbia |
| Plant Part Used | Bark, Catkin |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bark is an appetizer, astringent, cathartic, cytostatic, emetic, stomachic and tonic, useful in treatment of headaches, rheumatic pains, internal injuries and diarrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Alnus%20rubra
|
| Curator | |
| Compound ID | 1201 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1229 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Rao, R.R.Ethnobotanical studies on the flora of Meghalaya -- Some interesting reports of herbal medicines.1981, S.K. Jain (Ed.), 137-148
|
| Curator | |
| Compound ID | 1284 |
| Compound Structure | |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin, Clarithromycin |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2, April 1998, Pages 137–145
|
| Curator | |
| Compound ID | 1303 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium avium (ATCC 25291) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1410 |
| Compound Structure | |
| Plant Source | Centella asiatica (L.) Urban Common Name:Asiatic Pennywort, Indian Pennywort (English), Mandukaparni, Mandukaparnikaa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Malaysia, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, treatment of leprosy and skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.himalayahealthcare.com/herbfinder/h_centel.htm
|
| Curator | |
| Compound ID | 1450 |
| Compound Structure | |
| Plant Source | Cinnamomum zeylandicum Breyn. Common Name:Cinnamon, Ceylon Cinnamon (English), Tvak, Daaruchini (Sanskrit) |
| Source Family | Lauraceae |
| Origin | Sri Lanka, Sumatra, Eastern Islands, Brazil, Mauritius, India, Jamaica |
| Plant Part Used | Bark |
| Extract | Methanol (9.41 %) |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic and used to treat gonorrhoea, asthma, diabetes, diseases of oral cavity, bronchitis, expectorant |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1525 |
| Compound Structure | |
| Plant Source | Commiphora mukul Engl. Common Name:Indian Bdellium tree (English), Guggulu (Sanskrit) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Resin |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands of neck, asthma, troubles of chest, expectorant, bronchitis, whooping cough, pulmonary tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1534 |
| Compound Structure | |
| Plant Source | Coptis teeta Wall. Common Name:Gold Thread (English), Mamira, Maamiraa, Tiktamuulaa (Sanskrit) |
| Source Family | Ranunculaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Water |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1627 |
| Compound Structure | |
| Plant Source | Empetrum nigrum L. Common Name:Black Crowberry |
| Source Family | Empetraceae |
| Origin | British Columbia |
| Plant Part Used | Stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, used as a diuretic, kidney problems, diarrhoea, colds |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
|
| Curator | |
| Compound ID | 1628 |
| Compound Structure | |
| Plant Source | Entada abyssinica A. Rich Common Name:Tree Entanda |
| Source Family | Fabaceae |
| Origin | Kenya |
| Plant Part Used | Stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10 % of the inoculum of the five mycobacterial species at 2 mg/ml |
| Activity [MIC] µg/ml | 0.5 - 4 mg/ml based on bacteria |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1631 |
| Compound Structure | |
| Plant Source | Equisetum arvense L. Common Name:Field Horsetail (English), Ashwa - Puchha (Sanskrit) |
| Source Family | Equisetaceae |
| Origin | India, Britain and Northern temperate region |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Recommended and effective in treatment of tuberculosis by older herbalists. Proved very effectual in spitting of blood. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1641 |
| Compound Structure | |
| Plant Source | Erigeron strigosus Muhl Common Name:Daisy Fleabane, Prairie Fleabane, Rough Fleabane |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin, Clarithromycin |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2, April 1998, Pages 137–145
|
| Curator | |
| Compound ID | 1663 |
| Compound Structure | |
| Plant Source | Eucalyptus globulus Labill Common Name:Blue Gum Tree (English), Tilaparna, Tailaparna, Sugandhapatra (Sanskrit) |
| Source Family | Myrtaceae |
| Origin | Brazil, Tasmania, Australia, South Europe |
| Plant Part Used | Leaf |
| Extract | Essential oil |
| Target Bacteria | MDR Mycobacterium tuberculosis, Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic, expectorant, stimulant, febrifuge and used to treat cough, respiratory disorders |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Moreira, Raquel R. D; Anno, Ivone S; Leite, Clarice Q. F.Sensitivity of mycobacteria to different species of Eucalyptus L herit.Rev. microbiol;28(4):256-60
|
| Curator | |
| Compound ID | 1722 |
| Compound Structure | |
| Plant Source | Euthamia leptocephala Greene Common Name:Bushy Goldentop |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2, April 1998, Pages 137–145
|
| Curator | |
| Compound ID | 1808 |
| Compound Structure | |
| Plant Source | Glehnia littoris F. Schmidt ssp Leiocarpa (Mathias) Hult. Common Name:Beach Silvertop, American Silvertop |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | British Columbia |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://netartsbaytoday.org/html/white_flowers.html
|
| Curator | |
| Compound ID | 1816 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1843 |
| Compound Structure | |
| Plant Source | Harrisonia abyssinica Oliv Common Name: |
| Source Family | Simaroubaceae |
| Origin | Kenya |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1863 |
| Compound Structure | |
| Plant Source | Heracleum maximum Bartr. Common Name:Common Cowparsnip |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | British Columbia |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Colic, cramps, headaches, sore throats, colds, coughs and flu, poultices used for sores, bruises, swelling, rheumatic joints and boils or other skin eruptions |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://www.ionxchange.com/products/HERACLEUM-MAXIMUM-|-Cow-Parnsip.html
|
| Curator | |
| Compound ID | 1878 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin sulfate (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 1893 |
| Compound Structure | |
| Plant Source | Hypericum perforatum L. Common Name:Common St. John's Wort (English) |
| Source Family | Hypericaceae |
| Origin | India, British Columbia |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid (10 µl of 10 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Wound healing, antiseptic and disinfectant qualities,cough, expectorant, chronic catarrh of lungs |
| PubMed ID [Source Literature] | 1453710 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McCutcheon AR, Ellis SM, Hancock RE, Towers GH.Antibiotic screening of medicinal plants of the British Columbian native peoples.J Ethnopharmacol. 1992 Oct;37(3):213-23
|
| Curator | |
| Compound ID | 1925 |
| Compound Structure | |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium, Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |