| Compound ID | 1003 |
| Compound Structure | |
| Plant Source | Abrus precatorius L. Common Name:Indian Wild Liquorice, Jequirity, Crab's Eye (English), Gunja, Gunjaka (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Puerto Rico, Nigeria |
| Plant Part Used | |
| Extract | Hexane (21.33 %) |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands, asthma, pain in chest, cough, bronchitis, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Ibrahim, K., Oyewale, A.O., Amupitan, J.O., and Okogun, J.I., 2009, Antimycobacterial activity of some medicinal plants in Niger State, Nigeria. Afri. J. Infect. Dis., 3(2), 44-48
2) Indian Medicinal Plants: An Illustrated Dictionary By C.P. Khare
|
| Curator | |
| Compound ID | 1104 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium bovis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1340 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1161 |
| Compound Structure | |
| Plant Source | Amborella trichopoda Baill. Common Name: |
| Source Family | Borellaceae |
| Origin | Caledonia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (20 µg/ml), Pyrazynamide (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 - 2.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cystitis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1162 |
| Compound Structure | |
| Plant Source | Amborella trichopoda Baill. Common Name: |
| Source Family | Borellaceae |
| Origin | Caledonia |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (2.5 µg/ml), Pyrazynamide (20 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cystitis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1163 |
| Compound Structure | |
| Plant Source | Amborella trichopoda Baill. Common Name: |
| Source Family | Borellaceae |
| Origin | Caledonia |
| Plant Part Used | Stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (2.5 µg/ml), Pyrazynamide (20 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cystitis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1164 |
| Compound Structure | |
| Plant Source | Amborella trichopoda Baill. Common Name: |
| Source Family | Borellaceae |
| Origin | Caledonia |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (2.5 µg/ml), Pyrazynamide (20 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cystitis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1165 |
| Compound Structure | |
| Plant Source | Amborella trichopoda Baill. Common Name: |
| Source Family | Borellaceae |
| Origin | Caledonia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (2.5 µg/ml), Pyrazynamide (20 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cystitis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1188 |
| Compound Structure | |
| Plant Source | Annona senegalensis Common Name:Wild Custard Apple, Wild Soursop |
| Source Family | Annonaceae |
| Origin | Nigeria |
| Plant Part Used | |
| Extract | Methanol (71.7 %) |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Ibrahim, K., Oyewale, A.O., Amupitan, J.O., and Okogun, J.I., 2009, Antimycobacterial activity of some me-dicinal plants in Niger State, Nigeria. Afri. J. Infect. Dis., 3(2), 44-48
|
| Curator | |
| Compound ID | 1192 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Hexane |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 312.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1193 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Ethyl acetate soluble |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 625 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1194 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1503 |
| Compound Structure | |
| Plant Source | Codiaeum peltatum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Caledonia |
| Plant Part Used | Stem |
| Extract | Ether, petroleum |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (20 µg/ml), Pyrazynamide (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1504 |
| Compound Structure | |
| Plant Source | Codiaeum peltatum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Caledonia |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (20 µg/ml), Pyrazynamide (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1505 |
| Compound Structure | |
| Plant Source | Codiaeum peltatum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Caledonia |
| Plant Part Used | Stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | 96 - well Microplate Dilution Method |
| Positive Control Used (conc.) | Ethambutol (20 µg/ml), Pyrazynamide (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15588670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Billo M, Cabalion P, Waikedre J, Fourneau C, Bouttier S, Hocquemiller R, Fournet A.Screening of some New Caledonian and Vanuatu medicinal plants for antimycobacterial activity.J Ethnopharmacol. 2005 Jan 4;96(1-2):195-200
|
| Curator | |
| Compound ID | 1549 |
| Compound Structure | |
| Plant Source | Crateva adansonii Common Name:Caper Tree |
| Source Family | Capparaceae |
| Origin | Nigeria |
| Plant Part Used | |
| Extract | Methanol (69 %) |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Ibrahim, K., Oyewale, A.O., Amupitan, J.O., and Okogun, J.I., 2009, Antimycobacterial activity of some me-dicinal plants in Niger State, Nigeria. Afri. J. Infect. Dis., 3(2), 44-48
2) www.africanethnomedicines.net
|
| Curator | |
| Compound ID | 1600 |
| Compound Structure | |
| Plant Source | Detarium microcarpium Common Name: |
| Source Family | Caesalpiniaceae |
| Origin | Nigeria |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Ibrahim, K., Oyewale, A.O., Amupitan, J.O., and Okogun, J.I., 2009, Antimycobacterial activity of some me-dicinal plants in Niger State, Nigeria. Afri. J. Infect. Dis., 3(2), 44-48
|
| Curator | |
| Compound ID | 1676 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 260.38 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1677 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 468.75 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1678 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 664.06 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1679 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium bovis ATCC |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.49 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 26.01 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1680 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis ATCC |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.49 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 48.76 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1681 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis ATCC |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.49 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 504.48 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1692 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 33.69 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Diospyrin |
| PubChem ID | 308140 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6
|
| SMILES | Oc1c(C2=CC(=O)c3c(C2=O)cc(cc3O)C)c(cc2c1C(=O)C=CC2=O)C |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1693 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 98.96 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neodiospyrin |
| PubChem ID | 16072922 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Napthoquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c2c(c(C3=CC(=O)c4c(C3=O)c(O)cc(c4)C)c(c1)C)C(=O)C=CC2=O |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1694 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 11.78 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 7 - Methyljuglone |
| PubChem ID | 26905 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 188.047 |
| Molecular Formula | C11H8O3
|
| SMILES | Oc1c2c(cc(c1)C)C(=O)C=CC2=O |
| XLogP | 0.898 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
