| Compound ID | 1109 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1231 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avian, Mycobacterium chelonae, Mycobacterium intracellulare, Mycobacterium tarrae |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10 % |
| Activity [MIC] µg/ml | 8000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1628 |
| Compound Structure | |
| Plant Source | Entada abyssinica A. Rich Common Name:Tree Entanda |
| Source Family | Fabaceae |
| Origin | Kenya |
| Plant Part Used | Stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10 % of the inoculum of the five mycobacterial species at 2 mg/ml |
| Activity [MIC] µg/ml | 0.5 - 4 mg/ml based on bacteria |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1738 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | Amikacin (0.25 µg/ml), Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3
|
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1739 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferchromone |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Sesquiterpene, Chromone, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 384.230 |
| Molecular Formula | C24H32O4
|
| SMILES | C1c2c(ccc1)OC1C(C2=O)CC([C@@](O1)(CC/C=C(/CCC=C(C)C)C)C)O |
| XLogP | 5.430 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1843 |
| Compound Structure | |
| Plant Source | Harrisonia abyssinica Oliv Common Name: |
| Source Family | Simaroubaceae |
| Origin | Kenya |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1965 |
| Compound Structure |  |
| Plant Source | Juniperus procera Hochst Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium intracellulare, Mycobacterium chelonae, Mycobacterium xenopi |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-Ferruginol |
| PubChem ID | 403773 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1cc2[C@@]3(C(C(CCC3)(C)C)CCc2cc1C(C)C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) I. Muhammad*, J.S. Mossa, F.S. El-Feraly.Antibacterial diterpenes from the leaves and seeds of Juniperus excelsa M. Bieb.Phytotherapy Research, Volume 6, Issue 5, pages 261–264, September/October 1992
2) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
3) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1968 |
| Compound Structure |  |
| Plant Source | Juniperus procera Hochst Common Name:African Pencil Cedar, Cedar, East African Cedar, East African Pencil Cedar, Pencil Cedar |
| Source Family | Cupressaceae |
| Origin | Saudi Arabia |
| Plant Part Used | Bark |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium xenopi, Mycobacterium chelonae / chelonei, Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-Totarol |
| PubChem ID | 460178 |
| Ethnomedicinal Information | Sore throat, chew fruits |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3(C(C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
2) http://www.worldagroforestrycentre.org/sea/Products/AFDbases/af/asp/SpeciesInfo.asp?SpID=1022
|
| Curator | |
| Compound ID | 1985 |
| Compound Structure | |
| Plant Source | Lamium amplexicaule L Common Name:Goldenseal |
| Source Family | Lamiaceae |
| Origin | India |
| Plant Part Used | Whole plant |
| Extract | Ethanol (80 %) |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.02 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | 3 mm, 7 mm |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Laxative, stimulant, diaphoretic, rheumatism, influenza |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Richardson M.D., Peterson J.R., Clark A.M. Bioactivity screenings of plants selected on the basis of folkloric use or presence of lignans in a family. Phytotherapy Research, Volume 6, Issue 5, pages 274–278, September/October 1992
|
| Curator | |
| Compound ID | 2624 |
| Compound Structure | |
| Plant Source | Spilanthes mauritiana A. Rich. DC. Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Kenya |
| Plant Part Used | Root, flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10 % of the inoculum of the five mycobacterial species at 2 mg/ml |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 2716 |
| Compound Structure | |
| Plant Source | Terminalia spinosa Engl Common Name:Small - Leaved Terminalia (English), Musosahwai (Sanskrit) |
| Source Family | Combretaceae |
| Origin | Kenya |
| Plant Part Used | Stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10% of the inoculum of the five mycobacterial species at 2 mg/ml |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
2) http://www.zimbabweflora.co.zw/speciesdata/species.php?species_id=142190
|
| Curator | |
| Compound ID | 2814 |
| Compound Structure | N/A |
| Plant Source | Ximenia caffra Sond Common Name:Sourplum (English), Munhengeni, Mutengeni, Mutsvanzva (Sanskrit) |
| Source Family | Olacaceae |
| Origin | Kenya |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium, Mycobacterium intracellulare, Mycobacterium chelonae / chelonei, Mycobacterium terrae |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10% of the inoculum of the five mycobacterial species at 2 mg/ml |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea and dysentery, fever, cough, venereal diseases |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
2) http://www.zimbabweflora.co.zw/speciesdata/species.php?species_id=121590
|
| Curator | |
| Compound ID | 3553 |
| Compound Structure |  |
| Plant Source | Colubrina retusa (Ditter) Common Name: |
| Source Family | Rhamnaceae |
| Origin | Venezuela |
| Plant Part Used | Stem |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare (ATCC 23068) |
| Assay / Test Done | OADC - Supplemented Middlebrook Broth |
| Positive Control Used (conc.) | Rifampin (0.3 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Jujubogenin 3 - O - α - L - Arabinofuranosyl (1-->2) - [3 - O - (Trans) - P - Coumaroyl - β - D - Glucopyranosyl (1-->3)] - α - L - Arabinopyranoside |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10514332 |
| Extract Preparation | Air dried stem were powdered, extracted at 37°C in ethanol, suspended in water and then again extracted with chloroform and then with butanol and finally evaporated to dryness to yield the compound |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Steroid, Pyran, Cinnamate, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1044.529 |
| Molecular Formula | C55H80O19 |
| SMILES | C1C[C@@H](C(C2[C@]1(C1[C@@](CC2)(C23C(CC1)C1C(C2)(OC(C[C@@]1(O)C)C=C(C)C)OC3)C)C)(C)C)OC1OC[C@@H]([C@@H]([C@@H]1OC1O[C@@H]([C@@H]([C@@H]1O)O)CO)O[C@@H]1OC([C@@H]([C@@H](C1O)OC(=O)/C=C/c1ccc(cc1)O)O)CO)O |
| XLogP | 5.255 |
| PSA | 282.210 |
| H-bond Donor | 9 |
| H-bond Acceptor | 19 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 10 |
| No. of N | 0 |
| No. of O | 19 |
| No. of S | 0 |
| Reference(s) | 1) ElSohly HN, Danner S, Li XC, Nimrod AC, Clark AM.New antimycobacterial saponin from Colubrina retusa.J Nat Prod. 1999 Sep;62(9):1341-2
|
| Curator | Farzana-shamsudeen, vikramjitmandal |
| Compound ID | 4149 |
| Compound Structure |  |
| Plant Source | Pimpinella sp. Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium smegmatis, Mycobacterium aurum, Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25-10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | NPMC10 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | C[C@@H](CC)C(=O)Oc1ccc([C@@]2(C)O[C@@H]2C)cc1 |
| XLogP | 3.891 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4150 |
| Compound Structure |  |
| Plant Source | Pimpinella sp. Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium smegmatis, Mycobacterium aurum, Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25-10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | NPMC11 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C/C(=CC)/C(=O)Oc1ccc([C@@]2(C)O[C@@H]2C)cc1 |
| XLogP | 3.773 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |