| Compound ID | 1118 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium xenopi |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2680 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1965 |
| Compound Structure |  |
| Plant Source | Juniperus procera Hochst Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium intracellulare, Mycobacterium chelonae, Mycobacterium xenopi |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-Ferruginol |
| PubChem ID | 403773 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1cc2[C@@]3(C(C(CCC3)(C)C)CCc2cc1C(C)C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) I. Muhammad*, J.S. Mossa, F.S. El-Feraly.Antibacterial diterpenes from the leaves and seeds of Juniperus excelsa M. Bieb.Phytotherapy Research, Volume 6, Issue 5, pages 261–264, September/October 1992
2) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
3) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1968 |
| Compound Structure |  |
| Plant Source | Juniperus procera Hochst Common Name:African Pencil Cedar, Cedar, East African Cedar, East African Pencil Cedar, Pencil Cedar |
| Source Family | Cupressaceae |
| Origin | Saudi Arabia |
| Plant Part Used | Bark |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium xenopi, Mycobacterium chelonae / chelonei, Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-Totarol |
| PubChem ID | 460178 |
| Ethnomedicinal Information | Sore throat, chew fruits |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3(C(C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
2) http://www.worldagroforestrycentre.org/sea/Products/AFDbases/af/asp/SpeciesInfo.asp?SpID=1022
|
| Curator | |
| Compound ID | 3968 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium xenopi |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferchromone |
| PubChem ID | NR |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Sesquiterpene, Chromone, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 384.230 |
| Molecular Formula | C24H32O4
|
| SMILES | C1c2c(ccc1)OC1C(C2=O)CC([C@@](O1)(CC/C=C(/CCC=C(C)C)C)C)O |
| XLogP | 5.430 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 3965 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium xenopi |
| Assay / Test Done | |
| Positive Control Used (conc.) | Amikacin (0.25 µg/ml), Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3
|
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |