| General Property |
| Molceule ID (DB) | EGIN0004339 |
| Inhibitor Class | Anilino-quinoline |
| Molecule Name in Refrence Article | 3e compound |
| IUPAC Name | N-{4-[(3-bromophenyl)amino]quinolin-6-yl}-4-(dimethylamino)butanamide |
| Formula | C21H23BrN4O |
| Mass | 427.338 |
| Exact Mass | 426.105524 |
| Composition | C (59.02%), H (5.42%), Br (18.7%), N (13.11%), O (3.74%) |
| Atom Count | 50 |
| PI | 11.9 |
| Smiles | c1(ccc2c(c1)c(ccn2)Nc1cc(ccc1)Br)NC(=O)CCCN(C)C |
| InChI | 1S/C21H23BrN4O/c1-26(2)12-4-7-21(27)25-17-8-9-19-18(14-17)20(10-11-23-19)24-16-6-3-5-15(22)13-16/h3,
5-6,8-11,13-14H,4,7,12H2,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | PHFAEZLTGYDQNR-UHFFFAOYSA-N |
| 2D Structure |  | Structure Backbone |  |
|
| View Structure in Jmol | Click to view 3 d structure Download Mol File |
| Drug Like Property | Druglikeliness |
| Symmetry & Geometry | Symmetry And Geometrical Information |
| Activity & Binding | Activity against isoform and covalant binding information |
| Topological Properties | Descriptors |
| Reference | 20222733 |
| Compounds from Reference | Other compounds from reference |
| Find Similar Compounds | |
| Reported activity against other enzymes | Lck | YES1 | EPH-B3 | RIPK2 | MINK1 | Src | PKD1 | MNK2 | MELK | EPH-A2 | PHK | CHK2 | CAMK1 | GCK | p38a | FGF-R1 | DYRK3 | AuroraB | BRSK2 | BTK | PRK2 | VEGFR | NUAK1 | CK1 | MKK1 | BRSK1 | PIM1 | SmMLCK | JNK1 | JNK2 | DYRK2 | SYK | PKBb | IKKB | JNK3 | p38b | MetNK1 | PIM3 | PAK5 | IRAK4 | IGF-1R | MAPKAP-K3 | CSK | CAMKKb | RSK2 | MARK4 | PIM2 | SRPK1 | p38d | MARK2 | PDK1 | IRR | MLK1 | PAK2 | PAK4 | MST4 | MST2 | PKCa | SGK1 | CHK1 | ERK1 | PAK6 | AMPK | MLK3 | PRAK | TBK1 | DYRK1A | ERK8 | IR-HIS | NEK6 | TTK | MAPKAP-K2 | PKA | PKCz | S6K1 | AuroraA | CDK2-CycA | ERK2 | ROCK2 | GSK3b | RSK1 | CK2 | IKKe | LKB1 | MARK3 | p38g | NEK2a | HIPK3 | MSK1 | EF2K | PKBa | HIPK1 | HIPK2 | PLK1 | ALL |
| Pub Chem Link |
-
|
| Drug Bank Link | - |
| ChemSpider Link | 24667480 |
| ChEMBL Link | CHEMBL1089524 |
