A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1002 |
| PubChem ID | 5282280 |
| Hormone name | 2-arachidonylglycerol |
| Description | binds to cannabinoid receptors; structure in first source |
| Synonyms | 2-Arachidonylglycerol 2-Ara-Gl 2-AG |
| Molecular weight | 378.55 |
| Molecular formula | C23H38O4 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Canonical smiles | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(CO)CO |
| Isomeric smiles | CCCCCC=C/CC=C/CC=C/CC=C/CCCC(=O)OC(CO)CO
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C13856 |
| HMDB ID | HMDB04666 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P47936 Detail in HMRbase |
| Comments | |
| References | Pubchem |