A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1005 |
| PubChem ID | 169870 |
| Hormone name | 17-alpha-hydroxy-progesterone caproate |
| Description | |
| Synonyms | Delalutin 17-alpha-hydroxy-progesterone caproate Primolut Depot Estralutin Hormofort Hyproval Kaprogest Syngynon Hylutin Relutin Lutate |
| Molecular weight | 428.6 |
| Molecular formula | C27H40O4 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] hexanoate |
| Canonical smiles | CCCCCC(=O)OC1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)C(=O)C |
| Isomeric smiles | CCCCCC(=O)O[C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)C(=O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C08148 D00949 |
| HMDB ID | N/A |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P06401 Detail in HMRbase P06186 Detail in HMRbase P59667 Detail in HMRbase |
| Comments | |
| References | Pubchem |