A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1022 |
| PubChem ID | 16533 |
| Hormone name | Betamethasone 17-Valerate |
| Description | The 17-valerate derivative of BETAMETHASONE. It has substantial topical anti-inflammatory activity and relatively low systemic anti-inflammatory activity. |
| Synonyms | beta-Val Betnovateat Celestoderm Betatrex Betnovate Betamethasone 17-Valerate Valisone Luxiq Betaderm Dermabet Valnac |
| Molecular weight | 476.58 |
| Molecular formula | C27H37FO6 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-1 7-yl] pentanoate |
| Canonical smiles | CCCCC(=O)OC1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)C)C(=O)CO |
| Isomeric smiles | CCCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)C)C(=O)CO
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D01357 |
| HMDB ID | N/A |
| Melting Point | 183-184(EXP) |
| Log P | 3.6(EXP) |
| Water Solubility | 9.29(EXP) at 25C |
| DrugBank ID | DB00443 |
| Drugpedia | wiki |
| Receptor | P04150 Detail in HMRbase |
| Comments | |
| References | Pubchem |