A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1026 |
| PubChem ID | 3033890 |
| Hormone name | Budesonide |
| Description | A glucocorticoid used in the management of ASTHMA, the treatment of various skin disorders, and allergic RHINITIS. |
| Synonyms | budesonide Cortivent Entocort Micronyl Preferid Pulmicort Respules Rhinocort Spirocort Budeson |
| Molecular weight | 430.53 |
| Molecular formula | C25H34O6 |
| IUPAC Name | N/A |
| Canonical smiles | CCCC1OC2CC3C4CCC5=CC(=O)C=CC5(C4C(CC3(C2(O1)C(=O)CO)C)O)C |
| Isomeric smiles | CCCC1O[C@H]2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@@]5([C@H]4[C@H](C[C@@]3([C@@]2(O1)C(=O)CO)C)O)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | N/A |
| Melting Point | 226(EXP) |
| Log P | 2.18(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB01222 |
| Drugpedia | wiki |
| Receptor | P04150 Detail in HMRbase |
| Comments | |
| References | Pubchem |