A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1027 |
| PubChem ID | 11289 |
| Hormone name | Chlorotrianisene |
| Description | A powerful synthetic, non-steroidal estrogen. |
| Synonyms | Chlorotrianizen Chlorestrolo Chlortrianisen Chlortrianisestrol Chlortrianisene Khlortrianizen Chloortrianisestrol |
| Molecular weight | 380.86 |
| Molecular formula | C23H21ClO3 |
| IUPAC Name | 1-[2-chloro-1,2-bis(4-methoxyphenyl)ethenyl]-4-methoxybenzene |
| Canonical smiles | COC1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)OC)Cl)C3=CC=C(C=C3)OC |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D00269 |
| HMDB ID | N/A |
| Melting Point | 115(EXP) |
| Log P | 6.22(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB00269 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase |
| Comments | |
| References | Pubchem |