A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1037 |
| PubChem ID | 13308 |
| Hormone name | Dehydrotestosterone |
| Description | RN given refers to (17beta)-isomer |
| Synonyms | Boldenone Dehydrotestosterone 1-Dehydrotestosterone 17beta-Boldenone dehydrotestosterone delta1-Testosterone 1,2-Dehydrotestosterone 1,2-Didehydrotestosterone Boldenone (INN) Boldenonum Boldenona |
| Molecular weight | 286.41 |
| Molecular formula | C19H26O2 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC3C(C1CCC2O)CCC4=CC(=O)C=CC34C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)C=C[C@]34C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14502 D07536 |
| HMDB ID | N/A |
| Melting Point | 165(EXP) |
| Log P | 3.05(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB01541 |
| Drugpedia | wiki |
| Receptor | P10275 Detail in HMRbase |
| Comments | |
| References | Pubchem |