A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1045 |
| PubChem ID | 667476 |
| Hormone name | Dienestrol |
| Description | A synthetic, non-steroidal estrogen structurally related to stilbestrol. It is used, usually as the cream, in the treatment of menopausal and postmenopausal symptoms. |
| Synonyms | Dienestrol Dehydrostilbestrol Dienoestrol bp alpha-Dienestrol Dienoestrolum Mesohexestrol Cycladiene Dienoestrol Dienestrol Estraguard Estrodienol |
| Molecular weight | 266.33 |
| Molecular formula | C18H18O2 |
| IUPAC Name | 4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
| Canonical smiles | CC=C(C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O |
| Isomeric smiles | CC=C(/C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C08090 D00898 |
| HMDB ID | N/A |
| Melting Point | 227.5(EXP) |
| Log P | 5.32(EST) |
| Water Solubility | 3(EXP) at 37C |
| DrugBank ID | DB00890 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase |
| Comments | |
| References | Pubchem |