A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1051 |
| PubChem ID | 9051 |
| Hormone name | Dydrogesterone |
| Description | A synthetic progestational hormone with no androgenic or estrogenic properties. Unlike many other progestational compounds, dydrogesterone produces no increase in temperature and does not inhibit OVULATION. |
| Synonyms | Dydrogesterone Hydrogesterone Isopregnenone Duphaston Gynorest Diphaston Gestatron Dufaston Duvaron |
| Molecular weight | 312.45 |
| Molecular formula | C21H28O2 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC(=O)C1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34C)C |
| Isomeric smiles | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@@H]3[C@H]2C=CC4=CC(=O)CC[C@@]34C)C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D01217 |
| HMDB ID | N/A |
| Melting Point | 169.5(EXP) |
| Log P | 3.45(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB00378 |
| Drugpedia | wiki |
| Receptor | P06401 Detail in HMRbase |
| Comments | |
| References | Pubchem |