A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1059 |
| PubChem ID | 91469 |
| Hormone name | Equol |
| Description | RN given refers to (S)-isomer; metabolite of daidzein in urine of animals |
| Synonyms | Equol 7,4'-dihydroxyisoflavan 4',7-dihydroxy-3,4-dihydroisoflavone equol 7-hydroxy-3-(4'-hydroxyphenyl)chroman equol (3S)-3-(4-hydroxyphenyl)chroman-7-ol |
| Molecular weight | 242.27 |
| Molecular formula | C15H14O3 |
| IUPAC Name | (3S)-3-(4-hydroxyphenyl)chroman-7-ol |
| Canonical smiles | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O |
| Isomeric smiles | C1[C@H](COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14131 |
| HMDB ID | N/A |
| Melting Point | 189.5(EXP) |
| Log P | 3.67(EST) |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | Q92731 Detail in HMRbase |
| Comments | |
| References | Pubchem |