A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1076 |
| PubChem ID | 5280961 |
| Hormone name | Genistein |
| Description | An isoflavonoid derived from soy products. It inhibits PROTEIN-TYROSINE KINASE and topoisomerase-II (DNA TOPOISOMERASES, TYPE II); activity and is used as an antineoplastic and antitumor agent. Experimentally, it has been shown to induce G2 PHASE arrest in human and murine cell lines and inhibits PROTEIN-TYROSINE KINASE. |
| Synonyms | Genistein Genisteol Genisterin Prunetol Sophoricol Genestein Genistein Differenol A Bonistein 4',5,7-Trihydroxyisoflavone Lactoferrin-genistein |
| Molecular weight | 270.24 |
| Molecular formula | C15H10O5 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Canonical smiles | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| Isomeric smiles | N/A
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C06563 |
| HMDB ID | HMDB03217 |
| Melting Point | 301.5(EXP) |
| Log P | 2.84(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB01645 |
| Drugpedia | wiki |
| Receptor | Q92731 Detail in HMRbase |
| Comments | |
| References | Pubchem |