A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1087 |
| PubChem ID | 6291 |
| Hormone name | Mestranol |
| Description | The 3-methyl ether of ETHINYL ESTRADIOL. It must be demethylated to be biologically active. It is used as the estrogen component of many combination ORAL CONTRACEPTIVES. |
| Synonyms | Mestranol Inostral Devocin Norquen Ovastol Menophase Norinyl Norinyl Enovid Ovulen Ortho-novum Norinyl |
| Molecular weight | 310.43 |
| Molecular formula | C21H26O2 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-ethynyl-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| Canonical smiles | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)OC |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)OC
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C07618 D00575 |
| HMDB ID | N/A |
| Melting Point | 150.5(EXP) |
| Log P | 4.68(EST) |
| Water Solubility | N/A |
| DrugBank ID | DB01357 |
| Drugpedia | wiki |
| Receptor | P03372 Detail in HMRbase |
| Comments | |
| References | Pubchem |