A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1089 |
| PubChem ID | 6300 |
| Hormone name | Methandrostenolone |
| Description | A synthetic steroid with anabolic properties that are more pronounced than its androgenic effects. It has little progestational activity. (From Martindale, The Extra Pharmacopoeia, 30th ed, p1188) |
| Synonyms | Dianabol Methandrostenolone Metandienone Metandienonum Methandrolone Metandienon Nerobolettes Andoredan Dianabole Metanabol |
| Molecular weight | 300.44 |
| Molecular formula | C20H28O2 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| Canonical smiles | CC12CCC3C(C1CCC2(C)O)CCC4=CC(=O)C=CC34C |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CCC4=CC(=O)C=C[C@]34C
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | D00389 |
| HMDB ID | N/A |
| Melting Point | 166(EXP) |
| Log P | 3.51(EST) |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | P15207 Detail in HMRbase |
| Comments | |
| References | Pubchem |